CAS 17511-21-6 is the registry number for 5-Chloro-2,4-diaminoquinazoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-chloroquinazoline-2,4-diamine (CAS 17511-21-6) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 5-chloroquinazoline-2,4-diamine. InChIKey: VEVDQDKAMWPQSF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 5-chloroquinazoline-2,4-diamine |
| InChIKey | VEVDQDKAMWPQSF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)