CAS 175153-18-1 appears in our catalog under these names: 2-Methoxy-4-phenylbenzoic acid, 98%, 3-Methoxy-(1,1'-biphenyl)-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-4-phenylbenzoic acid (CAS 175153-18-1) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-methoxy-4-phenylbenzoic acid. InChIKey: WRDIRXZLYQHBPH-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-methoxy-4-phenylbenzoic acid |
| InChIKey | WRDIRXZLYQHBPH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)