CAS 175168-73-7 is the registry number for rac-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid (CAS 175168-73-7) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: trans-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: GDGXBNVMCFKSFP-NKWVEPMBSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | trans-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | GDGXBNVMCFKSFP-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)