Products 175168-73-7

CAS 175168-73-7 is the registry number for rac-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid (CAS 175168-73-7) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: trans-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: GDGXBNVMCFKSFP-NKWVEPMBSA-N.

Identity
Molecular formulaC10H8Cl2O2
Molecular weight231.07 g/mol
IUPAC nametrans-(1R,2R)-2-(2,3-dichlorophenyl)cyclopropane-1-carboxylic acid
InChIKeyGDGXBNVMCFKSFP-NKWVEPMBSA-N
SMILESC1[C@H]([C@@H]1C(=O)O)C2=C(C(=CC=C2)Cl)Cl

Computed by PubChem (NCBI)