CAS 702670-42-6 is the registry number for 3-[(3-Chlorobenzyl)sulfonyl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(3-chlorophenyl)methylsulfonyl]propanoic acid (CAS 702670-42-6) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: 3-[(3-chlorophenyl)methylsulfonyl]propanoic acid. InChIKey: XYPXITILIJCXTO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | 3-[(3-chlorophenyl)methylsulfonyl]propanoic acid |
| InChIKey | XYPXITILIJCXTO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CS(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)