Products 1803560-95-3
CAS 1803560-95-3 appears in our catalog under these names: Methyl 3-(chlorosulfonyl)-2-phenylpropanoate, 95%, Methyl 3-(chlorosulfonyl)-2-phenylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 3-chlorosulfonyl-2-phenylpropanoate (CAS 1803560-95-3) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: methyl 3-chlorosulfonyl-2-phenylpropanoate. InChIKey: WWYNHZWNQNGIPF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | methyl 3-chlorosulfonyl-2-phenylpropanoate |
| InChIKey | WWYNHZWNQNGIPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CS(=O)(=O)Cl)C1=CC=CC=C1 |
Computed by PubChem (NCBI)