CAS 924859-48-3 appears in our catalog under these names: Ethyl 5-(chlorosulfonyl)-2-methylbenzoate, 95%, Ethyl 5-(chlorosulfonyl)-2-methylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Ethyl 5-chlorosulfonyl-2-methylbenzoate (CAS 924859-48-3) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: ethyl 5-chlorosulfonyl-2-methylbenzoate. InChIKey: DWBXCYREJOEVOL-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | ethyl 5-chlorosulfonyl-2-methylbenzoate |
| InChIKey | DWBXCYREJOEVOL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)