CAS 923207-43-6 appears in our catalog under these names: Propyl 4-(chlorosulfonyl)benzoate, 95%, Propyl 4-(chlorosulfonyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Propyl 4-chlorosulfonylbenzoate (CAS 923207-43-6) is a chemical compound with the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. IUPAC name: propyl 4-chlorosulfonylbenzoate. InChIKey: XBTYFDSZELIUFF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO4S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | propyl 4-chlorosulfonylbenzoate |
| InChIKey | XBTYFDSZELIUFF-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)