CAS 175465-93-7 appears in our catalog under these names: Benzyl 2-methanesulfonylacetate, 95%, Benzyl 2-methanesulfonylacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Benzyl 2-methylsulfonylacetate (CAS 175465-93-7) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: benzyl 2-methylsulfonylacetate. InChIKey: CBJZWSNCLNIXKD-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | benzyl 2-methylsulfonylacetate |
| InChIKey | CBJZWSNCLNIXKD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)