Products 175543-27-8
CAS 175543-27-8 appears in our catalog under these names: 2，2–difluoro–2–(3–(trifluoromethyl)phenyl)acetic acid, 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetic acid, 2,2-difluoro-2-(3-(trifluoromethyl)phenyl)acetic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 50mg.
2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetic acid (CAS 175543-27-8) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetic acid. InChIKey: JKPKFHWZTODWIF-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | JKPKFHWZTODWIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)