CAS 175693-04-6 is the registry number for 3-Methyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-2-oxo-1,3-benzothiazole-6-carbaldehyde (CAS 175693-04-6) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 3-methyl-2-oxo-1,3-benzothiazole-6-carbaldehyde. InChIKey: LYNTYPVVJROQNF-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 3-methyl-2-oxo-1,3-benzothiazole-6-carbaldehyde |
| InChIKey | LYNTYPVVJROQNF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C=O)SC1=O |
Computed by PubChem (NCBI)