Products 17585-69-2
CAS 17585-69-2 appears in our catalog under these names: (S)-2-Amino-3-phenylpropanoic acid hydrochloride, 95%, L-Phenylalanine hydrochloride, 98%, L–Phenylalanine hydrochloride, L-Phenylalanine hydrochloride, 99%, 99%. Offered by: Fluorochem, Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg, 10g.
(2S)-2-amino-3-phenylpropanoic acid;hydrochloride (CAS 17585-69-2) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: (2S)-2-amino-3-phenylpropanoic acid;hydrochloride. InChIKey: ZAIZDXVMSSDZFA-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | (2S)-2-amino-3-phenylpropanoic acid;hydrochloride |
| InChIKey | ZAIZDXVMSSDZFA-QRPNPIFTSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
phenylalanine hydrochloride, L-Phenylalanine hydrochloride, (S)-2-Amino-3-phenylpropanoic acid hydrochloride, (2S)-2-amino-3-phenylpropanoic acid hydrochloride, (2S)-2-amino-3-phenylpropanoic acid;hydrochloride, 3-Phenyl-L-alanine HCl, L-Phenylalanine, hydrochloride, 3-Phenyl-L-alanine hydrochloride, Alanine, phenyl-, hydrochloride, L-, L-Phenylalanine monohydrochloride