CAS 28069-46-7 is the registry number for D-Phenylalanine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2R)-2-amino-3-phenylpropanoic acid;hydrochloride (CAS 28069-46-7) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: (2R)-2-amino-3-phenylpropanoic acid;hydrochloride. InChIKey: ZAIZDXVMSSDZFA-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | (2R)-2-amino-3-phenylpropanoic acid;hydrochloride |
| InChIKey | ZAIZDXVMSSDZFA-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)