Products 176212-48-9
CAS 176212-48-9 is the registry number for 3'-(Hydroxymethyl)biphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[3-(hydroxymethyl)phenyl]benzoic acid (CAS 176212-48-9) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 3-[3-(hydroxymethyl)phenyl]benzoic acid. InChIKey: SWVDMIKPVOEKNC-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 3-[3-(hydroxymethyl)phenyl]benzoic acid |
| InChIKey | SWVDMIKPVOEKNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)CO |
Computed by PubChem (NCBI)
Synonyms:
3'-(Hydroxymethyl)-[1,1'-biphenyl]-3-carboxylic acid, 3'-(Hydroxymethyl)biphenyl-3-carboxylic acid, 3-[3-(hydroxymethyl)phenyl]benzoic acid, 3'-(Hydroxymethyl)[1,1'-biphenyl]-3-carboxylic acid, [1,1'-Biphenyl]-3-carboxylic acid, 3'-(hydroxymethyl)-, 3'-(Hydroxymethyl)-[1,1'-biphenyl]-3-carboxylicacid, 3''-(Hydroxymethyl)biphenyl-3-carboxylic Acid, QKU