CAS 17625-83-1 appears in our catalog under these names: 4′–Aminobenzanilide, 4'-Aminobenzanilide, 97% , 4-Aminobenzanilide 95%, 4'-Aminobenzanilide, 95%, 95%, 4'-Aminobenzanilide, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 250mg.
N-(4-aminophenyl)benzamide (CAS 17625-83-1) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: N-(4-aminophenyl)benzamide. InChIKey: GTTFJYUWPUKXJH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | N-(4-aminophenyl)benzamide |
| InChIKey | GTTFJYUWPUKXJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)