CAS 1769-88-6 appears in our catalog under these names: 8-Hydroxy-1-naphthoic acid, 97%, 8-Hydroxynaphthalene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
8-hydroxynaphthalene-1-carboxylic acid (CAS 1769-88-6) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 8-hydroxynaphthalene-1-carboxylic acid. InChIKey: SHOOSJLGRQTMFC-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 8-hydroxynaphthalene-1-carboxylic acid |
| InChIKey | SHOOSJLGRQTMFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C(=CC=C2)O |
Computed by PubChem (NCBI)