Products 1772741-96-4
CAS 1772741-96-4 is the registry number for 5-Bromo-6-(3-(hydroxymethyl)phenoxy)-3,4-dihydropyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-4-[3-(hydroxymethyl)phenoxy]-1H-pyrimidin-6-one (CAS 1772741-96-4) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: 5-bromo-4-[3-(hydroxymethyl)phenoxy]-1H-pyrimidin-6-one. InChIKey: UQDIEHLTZUADMW-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | 5-bromo-4-[3-(hydroxymethyl)phenoxy]-1H-pyrimidin-6-one |
| InChIKey | UQDIEHLTZUADMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=C(C(=O)NC=N2)Br)CO |
Computed by PubChem (NCBI)