Products 177721-72-1
CAS 177721-72-1 appears in our catalog under these names: (S)–Methyl 2–(benzylamino)–3–methylbutanoate hydrochloride, Bzl-Val-OMe HCl 97%, BZL-VAL-OME HCL, 97%, 97%, (S)-Methyl 2-(benzylamino)-3-methylbutanoate hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 25g, 1g.
Methyl (2S)-2-(benzylamino)-3-methylbutanoate;hydrochloride (CAS 177721-72-1) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: methyl (2S)-2-(benzylamino)-3-methylbutanoate;hydrochloride. InChIKey: WCFZNEINMPTYRU-YDALLXLXSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | methyl (2S)-2-(benzylamino)-3-methylbutanoate;hydrochloride |
| InChIKey | WCFZNEINMPTYRU-YDALLXLXSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)
Synonyms:
BZL-VAL-OME HCL, (S)-Methyl 2-(benzylamino)-3-methylbutanoate hydrochloride, Methyl benzyl-L-valinate hydrochloride, N-BENZYL-L-VALINE METHYL ESTER HYDROCHLORIDE, Bzl-Val-OMe hydrochloride, L-Valine, N-(phenylmethyl)-, methyl ester, hydrochloride (9CI), methyl (2S)-2-(benzylamino)-3-methylbutanoate;hydrochloride, Bzl-L-Val-OMe HCl, Methyl N-benzyl-L-valinate--hydrogen chloride (1/1), Benzyl-L-valine methyl ester hydrochloride>/= 99% (HPLC)