Products 177760-48-4

CAS 177760-48-4 is the registry number for 2-tert-Butyl 5-methyl pyridine-2,5-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 5-O-methyl pyridine-2,5-dicarboxylate (CAS 177760-48-4) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl pyridine-2,5-dicarboxylate. InChIKey: SVENRSFSQPOSJF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO4
Molecular weight237.25 g/mol
IUPAC name2-O-tert-butyl 5-O-methyl pyridine-2,5-dicarboxylate
InChIKeySVENRSFSQPOSJF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=NC=C(C=C1)C(=O)OC

Computed by PubChem (NCBI)