CAS 177760-48-4 is the registry number for 2-tert-Butyl 5-methyl pyridine-2,5-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-O-tert-butyl 5-O-methyl pyridine-2,5-dicarboxylate (CAS 177760-48-4) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl pyridine-2,5-dicarboxylate. InChIKey: SVENRSFSQPOSJF-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-methyl pyridine-2,5-dicarboxylate |
| InChIKey | SVENRSFSQPOSJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)