CAS 1779766-11-8 appears in our catalog under these names: 5-Bromo-1-phenyl-1H-1,2,3-triazole-4-carboxylic acid, 96%, 96%, 5-Bromo-1-phenyl-1H-1,2,3-triazole-4-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg.
5-bromo-1-phenyltriazole-4-carboxylic acid (CAS 1779766-11-8) is a chemical compound with the molecular formula C9H6BrN3O2 and a molecular weight of 268.07 g/mol. IUPAC name: 5-bromo-1-phenyltriazole-4-carboxylic acid. InChIKey: MVCJKHXRKYOVTL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3O2 |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 5-bromo-1-phenyltriazole-4-carboxylic acid |
| InChIKey | MVCJKHXRKYOVTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(N=N2)C(=O)O)Br |
Computed by PubChem (NCBI)