Products 1779786-54-7

CAS 1779786-54-7 is the registry number for 6-Fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 1779786-54-7) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 6-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: OSMYJRVPLJZSLA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7FO3
Molecular weight182.15 g/mol
IUPAC name6-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid
InChIKeyOSMYJRVPLJZSLA-UHFFFAOYSA-N
SMILESC1COC2=C1C=CC(=C2C(=O)O)F

Computed by PubChem (NCBI)