CAS 17801-99-9 is the registry number for 1,4-Dichloro-2-methoxy-5-nitrobenzene, 97%. Offered by: AmBeed. Available pack sizes: 100mg, 25g.
1,4-dichloro-2-methoxy-5-nitrobenzene (CAS 17801-99-9) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: 1,4-dichloro-2-methoxy-5-nitrobenzene. InChIKey: DVGWQGRGSAQPQJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | 1,4-dichloro-2-methoxy-5-nitrobenzene |
| InChIKey | DVGWQGRGSAQPQJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)