Products 1780215-96-4
CAS 1780215-96-4 appears in our catalog under these names: 3-(1-Fluorocyclopropyl)benzoic acid 95%, 3-(1-Fluorocyclopropyl)benzoic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 25mg.
3-(1-fluorocyclopropyl)benzoic acid (CAS 1780215-96-4) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 3-(1-fluorocyclopropyl)benzoic acid. InChIKey: XEJZLSUTHQTORD-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 3-(1-fluorocyclopropyl)benzoic acid |
| InChIKey | XEJZLSUTHQTORD-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3-(1-fluorocyclopropyl)benzoic acid