Products 1780879-76-6
CAS 1780879-76-6 is the registry number for 7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylic acid (CAS 1780879-76-6) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylic acid. InChIKey: DUGQOSWZLIEPRG-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 7-methyl-2-oxo-3H-1,3-benzoxazole-5-carboxylic acid |
| InChIKey | DUGQOSWZLIEPRG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)