CAS 1782214-35-0 is the registry number for 6-bromo-2-chlorothieno[2,3-b]pyrazine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6-bromo-2-chlorothieno[2,3-b]pyrazine (CAS 1782214-35-0) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 6-bromo-2-chlorothieno[2,3-b]pyrazine. InChIKey: MRVVATDCUZHPPP-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 6-bromo-2-chlorothieno[2,3-b]pyrazine |
| InChIKey | MRVVATDCUZHPPP-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=NC=C(N=C21)Cl)Br |
Computed by PubChem (NCBI)