Products 1782429-68-8
CAS 1782429-68-8 appears in our catalog under these names: 2-Bromo-1h-indole-6-carboxylic acid, 95%, 2-Bromo-1H-indole-6-carboxylicacid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-bromo-1H-indole-6-carboxylic acid (CAS 1782429-68-8) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 2-bromo-1H-indole-6-carboxylic acid. InChIKey: PHUMXXWPXYBLDE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 2-bromo-1H-indole-6-carboxylic acid |
| InChIKey | PHUMXXWPXYBLDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=C2)Br |
Computed by PubChem (NCBI)