CAS 17828-45-4 appears in our catalog under these names: 4-(4-Aminophenyl)benzene-1,2-diamine, (1,1'-Biphenyl)-3,4,4'-triamine, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
4-(4-aminophenyl)benzene-1,2-diamine (CAS 17828-45-4) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 4-(4-aminophenyl)benzene-1,2-diamine. InChIKey: RVYIVHUVZXDTGN-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-(4-aminophenyl)benzene-1,2-diamine |
| InChIKey | RVYIVHUVZXDTGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)N)N)N |
Computed by PubChem (NCBI)