CAS 777887-21-5 is the registry number for 2-(2,3-Dichlorophenyl)azetidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(2,3-dichlorophenyl)azetidine (CAS 777887-21-5) is a chemical compound with the molecular formula C9H9Cl2N and a molecular weight of 202.08 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)azetidine. InChIKey: JJKNSJYXKGDLJZ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2N |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)azetidine |
| InChIKey | JJKNSJYXKGDLJZ-UHFFFAOYSA-N |
| SMILES | C1CNC1C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)