CAS 1784507-62-5 appears in our catalog under these names: 5-Bromo-1H-indole-4-carboxylic acid, 97%, 97%, 5-Bromo-1H-indole-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
5-bromo-1H-indole-4-carboxylic acid (CAS 1784507-62-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1H-indole-4-carboxylic acid. InChIKey: KJVMWYWXKXHOHQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1H-indole-4-carboxylic acid |
| InChIKey | KJVMWYWXKXHOHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC=C2)C(=O)O)Br |
Computed by PubChem (NCBI)