CAS 1785228-36-5 is the registry number for 2-Oxo-1,4-dihydro-2H-benzo[d][1,3]oxazine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-1,4-dihydro-3,1-benzoxazine-5-carboxylic acid (CAS 1785228-36-5) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 2-oxo-1,4-dihydro-3,1-benzoxazine-5-carboxylic acid. InChIKey: PSRLPRMCPBSIIK-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-oxo-1,4-dihydro-3,1-benzoxazine-5-carboxylic acid |
| InChIKey | PSRLPRMCPBSIIK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2NC(=O)O1)C(=O)O |
Computed by PubChem (NCBI)