Products 1785228-36-5

CAS 1785228-36-5 is the registry number for 2-Oxo-1,4-dihydro-2H-benzo[d][1,3]oxazine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-oxo-1,4-dihydro-3,1-benzoxazine-5-carboxylic acid (CAS 1785228-36-5) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 2-oxo-1,4-dihydro-3,1-benzoxazine-5-carboxylic acid. InChIKey: PSRLPRMCPBSIIK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO4
Molecular weight193.16 g/mol
IUPAC name2-oxo-1,4-dihydro-3,1-benzoxazine-5-carboxylic acid
InChIKeyPSRLPRMCPBSIIK-UHFFFAOYSA-N
SMILESC1C2=C(C=CC=C2NC(=O)O1)C(=O)O

Computed by PubChem (NCBI)