Products 1788041-62-2
CAS 1788041-62-2 appears in our catalog under these names: Dimethyl 6-methyl-1h-indazole-3,5-dicarboxylate, 95%, Dimethyl 6-methyl-1H-indazole-3,5-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
Dimethyl 6-methyl-1H-indazole-3,5-dicarboxylate (CAS 1788041-62-2) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: dimethyl 6-methyl-1H-indazole-3,5-dicarboxylate. InChIKey: IENUJCRRILKSAA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | dimethyl 6-methyl-1H-indazole-3,5-dicarboxylate |
| InChIKey | IENUJCRRILKSAA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=O)OC)C(=NN2)C(=O)OC |
Computed by PubChem (NCBI)