Products 1788946-81-5

CAS 1788946-81-5 is the registry number for 3-(1-Methyl-1H-pyrazol-4-yl)thiomorpholine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide (CAS 1788946-81-5) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide. InChIKey: AEYACIYNEYLFGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13N3O2S
Molecular weight215.28 g/mol
IUPAC name3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide
InChIKeyAEYACIYNEYLFGQ-UHFFFAOYSA-N
SMILESCN1C=C(C=N1)C2CS(=O)(=O)CCN2

Computed by PubChem (NCBI)