CAS 1788946-81-5 is the registry number for 3-(1-Methyl-1H-pyrazol-4-yl)thiomorpholine 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide (CAS 1788946-81-5) is a chemical compound with the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide. InChIKey: AEYACIYNEYLFGQ-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide |
| InChIKey | AEYACIYNEYLFGQ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2CS(=O)(=O)CCN2 |
Computed by PubChem (NCBI)