CAS 179057-31-9 is the registry number for 4-(1,3-Oxazol-5-yl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,3-oxazol-5-yl)benzaldehyde (CAS 179057-31-9) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 4-(1,3-oxazol-5-yl)benzaldehyde. InChIKey: GDXLZBAOBKGCEK-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 4-(1,3-oxazol-5-yl)benzaldehyde |
| InChIKey | GDXLZBAOBKGCEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CN=CO2 |
Computed by PubChem (NCBI)