Products 1794759-59-3
CAS 1794759-59-3 appears in our catalog under these names: 3–Hydroxycarbofuran–d3, 3-Hydroxycarbofuran-d3, 3-Hydroxy Carbofuran-d3, >95% (HPLC). Offered by: GLPBio, MedChemExpress, TRC. Available pack sizes: 1mg, 1 mg, 10mg.
(3-hydroxy-2,2-dimethyl-3H-1-benzofuran-7-yl) N-(trideuteriomethyl)carbamate (CAS 1794759-59-3) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 240.27 g/mol. IUPAC name: (3-hydroxy-2,2-dimethyl-3H-1-benzofuran-7-yl) N-(trideuteriomethyl)carbamate. InChIKey: RHSUJRQZTQNSLL-HPRDVNIFSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | (3-hydroxy-2,2-dimethyl-3H-1-benzofuran-7-yl) N-(trideuteriomethyl)carbamate |
| InChIKey | RHSUJRQZTQNSLL-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)OC1=CC=CC2=C1OC(C2O)(C)C |
Computed by PubChem (NCBI)