Products 2140327-57-5
CAS 2140327-57-5 appears in our catalog under these names: 3-Hydroxy Carbofuran-d6, D6-3-Hydroxycarbofuran, D6-3-Hydroxycarbofuran, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, HPC Standards. Available pack sizes: 250mg, 1x10mg, 1x1ml.
[3-hydroxy-2,2-bis(trideuteriomethyl)-3H-1-benzofuran-7-yl] N-methylcarbamate (CAS 2140327-57-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 243.29 g/mol. IUPAC name: [3-hydroxy-2,2-bis(trideuteriomethyl)-3H-1-benzofuran-7-yl] N-methylcarbamate. InChIKey: RHSUJRQZTQNSLL-WFGJKAKNSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 243.29 g/mol |
| IUPAC name | [3-hydroxy-2,2-bis(trideuteriomethyl)-3H-1-benzofuran-7-yl] N-methylcarbamate |
| InChIKey | RHSUJRQZTQNSLL-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1(C(C2=C(O1)C(=CC=C2)OC(=O)NC)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)