CAS 1794780-30-5 is the registry number for 1-Descarbamoyl-2-carbamoyl Methocarbamol-d5. Offered by: TRC. Available pack sizes: 100mg, 2,5mg, 25mg.
[1,1,2,3,3-pentadeuterio-1-hydroxy-3-(2-methoxyphenoxy)propan-2-yl] carbamate (CAS 1794780-30-5) is a chemical compound with the molecular formula C11H15NO5 and a molecular weight of 246.27 g/mol. IUPAC name: [1,1,2,3,3-pentadeuterio-1-hydroxy-3-(2-methoxyphenoxy)propan-2-yl] carbamate. InChIKey: SGJBZNIRQFJMEA-RORPNYJOSA-N.
| Molecular formula | C11H15NO5 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | [1,1,2,3,3-pentadeuterio-1-hydroxy-3-(2-methoxyphenoxy)propan-2-yl] carbamate |
| InChIKey | SGJBZNIRQFJMEA-RORPNYJOSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC=C1OC)OC(=O)N)O |
Computed by PubChem (NCBI)