Products 1794786-68-7
CAS 1794786-68-7 appears in our catalog under these names: Acedoben-d4, Acedoben–d4. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 10mg.
4-acetamido-2,3,5,6-tetradeuteriobenzoic acid (CAS 1794786-68-7) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 4-acetamido-2,3,5,6-tetradeuteriobenzoic acid. InChIKey: QCXJEYYXVJIFCE-QFFDRWTDSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 4-acetamido-2,3,5,6-tetradeuteriobenzoic acid |
| InChIKey | QCXJEYYXVJIFCE-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])NC(=O)C)[2H] |
Computed by PubChem (NCBI)