Products 1795136-87-6
CAS 1795136-87-6 is the registry number for Isometheptene-d3 Maleate, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
(E)-but-2-enedioic acid;6-methyl-N-(trideuteriomethyl)hept-5-en-2-amine (CAS 1795136-87-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 260.34 g/mol. IUPAC name: (E)-but-2-enedioic acid;6-methyl-N-(trideuteriomethyl)hept-5-en-2-amine. InChIKey: RNTSDCLIDWKCPL-UVZNBYNISA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 260.34 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;6-methyl-N-(trideuteriomethyl)hept-5-en-2-amine |
| InChIKey | RNTSDCLIDWKCPL-UVZNBYNISA-N |
| SMILES | [2H]C([2H])([2H])NC(C)CCC=C(C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Isometheptene-d3 Maleate