Products 51277-00-0
CAS 51277-00-0 appears in our catalog under these names: Isometheptene Maleate, >95% (HPLC), Isometheptene maleate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg.
(Z)-but-2-enedioic acid;N,6-dimethylhept-5-en-2-amine (CAS 51277-00-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (Z)-but-2-enedioic acid;N,6-dimethylhept-5-en-2-amine. InChIKey: RNTSDCLIDWKCPL-BTJKTKAUSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;N,6-dimethylhept-5-en-2-amine |
| InChIKey | RNTSDCLIDWKCPL-BTJKTKAUSA-N |
| SMILES | CC(CCC=C(C)C)NC.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)