Products 1795278-26-0
CAS 1795278-26-0 is the registry number for 3-(4-Chlorophenyl)-8-azabicyclo(3.2.1)octan-3-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-chlorophenyl)-8-azabicyclo[3.2.1]octan-3-ol;hydrochloride (CAS 1795278-26-0) is a chemical compound with the molecular formula C13H17Cl2NO and a molecular weight of 274.18 g/mol. IUPAC name: 3-(4-chlorophenyl)-8-azabicyclo[3.2.1]octan-3-ol;hydrochloride. InChIKey: SNIRHICAFUANRI-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2NO |
|---|---|
| Molecular weight | 274.18 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-8-azabicyclo[3.2.1]octan-3-ol;hydrochloride |
| InChIKey | SNIRHICAFUANRI-UHFFFAOYSA-N |
| SMILES | C1CC2CC(CC1N2)(C3=CC=C(C=C3)Cl)O.Cl |
Computed by PubChem (NCBI)