CAS 1797123-21-7 appears in our catalog under these names: 2,3-Dichloro-N-ethylaniline hydrochloride, 95%, 2,3-Dichloro-N-ethylaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2,3-dichloro-N-ethylaniline;hydrochloride (CAS 1797123-21-7) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 2,3-dichloro-N-ethylaniline;hydrochloride. InChIKey: YJQFIQRKXPNAJF-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 2,3-dichloro-N-ethylaniline;hydrochloride |
| InChIKey | YJQFIQRKXPNAJF-UHFFFAOYSA-N |
| SMILES | CCNC1=C(C(=CC=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)