CAS 1798728-20-7 is the registry number for 2-(3-Methoxypyridin-2-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3-methoxy-2-pyridinyl)acetic acid;hydrochloride (CAS 1798728-20-7) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 2-(3-methoxy-2-pyridinyl)acetic acid;hydrochloride. InChIKey: ICLUCUKWZGAJSP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 2-(3-methoxy-2-pyridinyl)acetic acid;hydrochloride |
| InChIKey | ICLUCUKWZGAJSP-UHFFFAOYSA-N |
| SMILES | COC1=C(N=CC=C1)CC(=O)O.Cl |
Computed by PubChem (NCBI)