CAS 179897-93-9 is the registry number for Methyl 2-bromo-3-methyl-5-nitrobenzoate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-bromo-3-methyl-5-nitrobenzoate (CAS 179897-93-9) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: methyl 2-bromo-3-methyl-5-nitrobenzoate. InChIKey: RSIFUNHBKKVOFE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | methyl 2-bromo-3-methyl-5-nitrobenzoate |
| InChIKey | RSIFUNHBKKVOFE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)