CAS 3300-16-1 is the registry number for Methyl 9-methylfluorene-9-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
Methyl 9-methylfluorene-9-carboxylate (CAS 3300-16-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: methyl 9-methylfluorene-9-carboxylate. InChIKey: IHPSWTZHVWAGFX-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | methyl 9-methylfluorene-9-carboxylate |
| InChIKey | IHPSWTZHVWAGFX-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=CC=CC=C31)C(=O)OC |
Computed by PubChem (NCBI)