Products 180068-67-1

CAS 180068-67-1 is the registry number for Methyl 3,5-difluoro-2-hydroxybenzoate, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

3,5-difluoro-2-methoxybenzoic acid (CAS 180068-67-1) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 3,5-difluoro-2-methoxybenzoic acid. InChIKey: MEVHLVDNBMQMNH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O3
Molecular weight188.13 g/mol
IUPAC name3,5-difluoro-2-methoxybenzoic acid
InChIKeyMEVHLVDNBMQMNH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1F)F)C(=O)O

Computed by PubChem (NCBI)