CAS 180068-67-1 is the registry number for Methyl 3,5-difluoro-2-hydroxybenzoate, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
3,5-difluoro-2-methoxybenzoic acid (CAS 180068-67-1) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 3,5-difluoro-2-methoxybenzoic acid. InChIKey: MEVHLVDNBMQMNH-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 3,5-difluoro-2-methoxybenzoic acid |
| InChIKey | MEVHLVDNBMQMNH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)F)C(=O)O |
Computed by PubChem (NCBI)