CAS 1801204-93-2 is the registry number for 4,4'-(Naphthalene-2,7-diyl)dianiline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[7-(4-aminophenyl)naphthalen-2-yl]aniline (CAS 1801204-93-2) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 4-[7-(4-aminophenyl)naphthalen-2-yl]aniline. InChIKey: INAZOHOKEOYQLP-UHFFFAOYSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 4-[7-(4-aminophenyl)naphthalen-2-yl]aniline |
| InChIKey | INAZOHOKEOYQLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)