Products 180182-02-9
CAS 180182-02-9 appears in our catalog under these names: 3-Amino-2-methyl-3-phenylpropanoic acid hydrochloride, 3-Amino-2-methyl-3-phenylpropanoic acid hydrochloride, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 100mg.
3-amino-2-methyl-3-phenylpropanoic acid;hydrochloride (CAS 180182-02-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 3-amino-2-methyl-3-phenylpropanoic acid;hydrochloride. InChIKey: GEZVTRMGOUQUGI-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 3-amino-2-methyl-3-phenylpropanoic acid;hydrochloride |
| InChIKey | GEZVTRMGOUQUGI-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC=CC=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)