CAS 1802080-61-0 is the registry number for 1-Cyclopropyl-2-nitro-naphthalene. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
1-cyclopropyl-2-nitronaphthalene (CAS 1802080-61-0) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 1-cyclopropyl-2-nitronaphthalene. InChIKey: SHEKWFZNQBNRBM-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 1-cyclopropyl-2-nitronaphthalene |
| InChIKey | SHEKWFZNQBNRBM-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=CC3=CC=CC=C32)[N+](=O)[O-] |
Computed by PubChem (NCBI)