CAS 1803030-67-2 appears in our catalog under these names: 3-Phenyl-2-((thiophen-2-yl)formamido)propanoic acid, (Thiophene-2-carbonyl)-L-phenylalanine, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 5g, 0,5g, 100mg.
3-phenyl-2-(thiophene-2-carbonylamino)propanoic acid (CAS 1803030-67-2) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 3-phenyl-2-(thiophene-2-carbonylamino)propanoic acid. InChIKey: VSMYIRFIBDUAEA-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 3-phenyl-2-(thiophene-2-carbonylamino)propanoic acid |
| InChIKey | VSMYIRFIBDUAEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)