CAS 929974-11-8 is the registry number for (2E)-3-(3-[(2-Methyl-1,3-thiazol-4-yl)methoxy]phenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoic acid (CAS 929974-11-8) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoic acid. InChIKey: SZCCAEUQQGNSKX-AATRIKPKSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | (E)-3-[3-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoic acid |
| InChIKey | SZCCAEUQQGNSKX-AATRIKPKSA-N |
| SMILES | CC1=NC(=CS1)COC2=CC=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)