CAS 381214-41-1 is the registry number for 3-Phenyl-2-[(thiophene-2-carbonyl)amino] propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
3-phenyl-2-(thiophene-2-carbonylamino)propanoic acid (CAS 381214-41-1) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 3-phenyl-2-(thiophene-2-carbonylamino)propanoic acid. InChIKey: VSMYIRFIBDUAEA-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 3-phenyl-2-(thiophene-2-carbonylamino)propanoic acid |
| InChIKey | VSMYIRFIBDUAEA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)